C10H14N6O3 — CID 20752290
N-[2-(2-aminoethoxy)ethyl]-4-azido-2-nitroaniline (PubChem CID 20752290) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-4-azido-2-nitroaniline.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-4-azido-2-nitroaniline |
|---|---|
| PubChem CID | 20752290 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-4-azido-2-nitroaniline |
| SMILES | [N-]=[N+]=Nc1ccc(NCCOCCN)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H14N6O3/c11-3-5-19-6-4-13-9-2-1-8(14-15-12)7-10(9)16(17)18/h1-2,7,13H,3-6,11H2 |
| InChIKey | DVYLCRXEWGXEQB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|