C25H25N7O2 — CID 3036564
N'-acridin-9-yl-N-(4-azido-2-nitrophenyl)hexane-1,6-diamine (PubChem CID 3036564) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is N'-acridin-9-yl-N-(4-azido-2-nitrophenyl)hexane-1,6-diamine.
| Compound Name | N'-acridin-9-yl-N-(4-azido-2-nitrophenyl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 3036564 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N'-acridin-9-yl-N-(4-azido-2-nitrophenyl)hexane-1,6-diamine |
| SMILES | [N-]=[N+]=Nc1ccc(NCCCCCCNc2c3ccccc3nc3ccccc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25N7O2/c26-31-30-18-13-14-23(24(17-18)32(33)34)27-15-7-1-2-8-16-28-25-19-9-3-5-11-21(19)29-22-12-6-4-10-20(22)25/h3-6,9-14,17,27H,1-2,7-8,15-16H2,(H,28,29) |
| InChIKey | QYJSHCAKGJCFOK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|