C40H36N8O — CID 3036556
N-[4-(acridin-9-ylamino)butyl]-N-[3-(acridin-9-ylamino)propyl]-4-azidobenzamide (PubChem CID 3036556) has the molecular formula C40H36N8O and a molecular weight of 644.78 g/mol. Its IUPAC name is N-[4-(acridin-9-ylamino)butyl]-N-[3-(acridin-9-ylamino)propyl]-4-azidobenzamide.
| Compound Name | N-[4-(acridin-9-ylamino)butyl]-N-[3-(acridin-9-ylamino)propyl]-4-azidobenzamide |
|---|---|
| PubChem CID | 3036556 |
| Molecular Formula | C40H36N8O |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | N-[4-(acridin-9-ylamino)butyl]-N-[3-(acridin-9-ylamino)propyl]-4-azidobenzamide |
| SMILES | [N-]=[N+]=Nc1ccc(C(=O)N(CCCCNc2c3ccccc3nc3ccccc23)CCCNc2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C40H36N8O/c41-47-46-29-22-20-28(21-23-29)40(49)48(27-11-25-43-39-32-14-3-7-18-36(32)45-37-19-8-4-15-33(37)39)26-10-9-24-42-38-30-12-1-5-16-34(30)44-35-17-6-2-13-31(35)38/h1-8,12-23H,9-11,24-27H2,(H,42,44)(H,43,45) |
| InChIKey | DYYVRBDFQSDERP-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 118.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|