C25H29N5O7 — CID 10207760
2-[[2-[2-(acridin-9-ylamino)ethylamino]-2-oxoethyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid (PubChem CID 10207760) has the molecular formula C25H29N5O7 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-[[2-[2-(acridin-9-ylamino)ethylamino]-2-oxoethyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[2-(acridin-9-ylamino)ethylamino]-2-oxoethyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 10207760 |
| Molecular Formula | C25H29N5O7 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 2-[[2-[2-(acridin-9-ylamino)ethylamino]-2-oxoethyl]-[2-[bis(carboxymethyl)amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)NCCNc1c2ccccc2nc2ccccc12)CC(=O)O |
| InChI | InChI=1S/C25H29N5O7/c31-21(13-29(14-22(32)33)11-12-30(15-23(34)35)16-24(36)37)26-9-10-27-25-17-5-1-3-7-19(17)28-20-8-4-2-6-18(20)25/h1-8H,9-16H2,(H,26,31)(H,27,28)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | ADRAJJAOVPUPQB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|