C18H19N3O2 — CID 71513367
3-[2-(acridin-9-ylamino)ethylamino]propanoic acid (PubChem CID 71513367) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[2-(acridin-9-ylamino)ethylamino]propanoic acid.
| Compound Name | 3-[2-(acridin-9-ylamino)ethylamino]propanoic acid |
|---|---|
| PubChem CID | 71513367 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 3-[2-(acridin-9-ylamino)ethylamino]propanoic acid |
| SMILES | O=C(O)CCNCCNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C18H19N3O2/c22-17(23)9-10-19-11-12-20-18-13-5-1-3-7-15(13)21-16-8-4-2-6-14(16)18/h1-8,19H,9-12H2,(H,20,21)(H,22,23) |
| InChIKey | DWGASWWJWGFGPA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|