C17H15N3O4 — CID 14580025
4-[(1-nitroacridin-9-yl)amino]butanoic acid (PubChem CID 14580025) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[(1-nitroacridin-9-yl)amino]butanoic acid.
| Compound Name | 4-[(1-nitroacridin-9-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 14580025 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 4-[(1-nitroacridin-9-yl)amino]butanoic acid |
| SMILES | O=C(O)CCCNc1c2ccccc2nc2cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C17H15N3O4/c21-15(22)9-4-10-18-17-11-5-1-2-6-12(11)19-13-7-3-8-14(16(13)17)20(23)24/h1-3,5-8H,4,9-10H2,(H,18,19)(H,21,22) |
| InChIKey | CWSPYTSBZVAWFX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|