C20H24N4O2 — CID 10089369
3-N,3-N-dimethyl-1-N-(1-nitroacridin-9-yl)pentane-1,3-diamine (PubChem CID 10089369) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1-N-(1-nitroacridin-9-yl)pentane-1,3-diamine.
| Compound Name | 3-N,3-N-dimethyl-1-N-(1-nitroacridin-9-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 10089369 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-N,3-N-dimethyl-1-N-(1-nitroacridin-9-yl)pentane-1,3-diamine |
| SMILES | CCC(CCNc1c2ccccc2nc2cccc([N+](=O)[O-])c12)N(C)C |
| InChI | InChI=1S/C20H24N4O2/c1-4-14(23(2)3)12-13-21-20-15-8-5-6-9-16(15)22-17-10-7-11-18(19(17)20)24(25)26/h5-11,14H,4,12-13H2,1-3H3,(H,21,22) |
| InChIKey | CYYQNHAWHJHKTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|