C18H22Cl2N4O2 — CID 21332770
1-N-ethyl-1-N'-(1-nitroacridin-9-yl)propane-1,1-diamine;dihydrochloride (PubChem CID 21332770) has the molecular formula C18H22Cl2N4O2 and a molecular weight of 397.31 g/mol. Its IUPAC name is 1-N-ethyl-1-N'-(1-nitroacridin-9-yl)propane-1,1-diamine;dihydrochloride.
| Compound Name | 1-N-ethyl-1-N'-(1-nitroacridin-9-yl)propane-1,1-diamine;dihydrochloride |
|---|---|
| PubChem CID | 21332770 |
| Molecular Formula | C18H22Cl2N4O2 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 1-N-ethyl-1-N'-(1-nitroacridin-9-yl)propane-1,1-diamine;dihydrochloride |
| SMILES | CCNC(CC)Nc1c2ccccc2nc2cccc([N+](=O)[O-])c12.Cl.Cl |
| InChI | InChI=1S/C18H20N4O2.2ClH/c1-3-16(19-4-2)21-18-12-8-5-6-9-13(12)20-14-10-7-11-15(17(14)18)22(23)24;;/h5-11,16,19H,3-4H2,1-2H3,(H,20,21);2*1H |
| InChIKey | CKCKFRGTFVEBIL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|