C18H20N4O2 — CID 21332765
1-N-(1-nitroacridin-9-yl)-1-N'-propan-2-ylethane-1,1-diamine (PubChem CID 21332765) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-N-(1-nitroacridin-9-yl)-1-N'-propan-2-ylethane-1,1-diamine.
| Compound Name | 1-N-(1-nitroacridin-9-yl)-1-N'-propan-2-ylethane-1,1-diamine |
|---|---|
| PubChem CID | 21332765 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-N-(1-nitroacridin-9-yl)-1-N'-propan-2-ylethane-1,1-diamine |
| SMILES | CC(C)NC(C)Nc1c2ccccc2nc2cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C18H20N4O2/c1-11(2)19-12(3)20-18-13-7-4-5-8-14(13)21-15-9-6-10-16(17(15)18)22(23)24/h4-12,19H,1-3H3,(H,20,21) |
| InChIKey | IAYODSCOWTVMAD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|