C23H19N3O2 — CID 139651637
3-[(2-phenyl-3-pyridin-4-ylquinolin-4-yl)amino]propanoic acid (PubChem CID 139651637) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[(2-phenyl-3-pyridin-4-ylquinolin-4-yl)amino]propanoic acid.
| Compound Name | 3-[(2-phenyl-3-pyridin-4-ylquinolin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 139651637 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-[(2-phenyl-3-pyridin-4-ylquinolin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)CCNc1c(-c2ccncc2)c(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C23H19N3O2/c27-20(28)12-15-25-23-18-8-4-5-9-19(18)26-22(17-6-2-1-3-7-17)21(23)16-10-13-24-14-11-16/h1-11,13-14H,12,15H2,(H,25,26)(H,27,28) |
| InChIKey | DIWHEFZLGQUDNQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |