C15H18N2O2 — CID 122048260
3-[(2-propylquinolin-4-yl)amino]propanoic acid (PubChem CID 122048260) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[(2-propylquinolin-4-yl)amino]propanoic acid.
| Compound Name | 3-[(2-propylquinolin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 122048260 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 3-[(2-propylquinolin-4-yl)amino]propanoic acid |
| SMILES | CCCc1cc(NCCC(=O)O)c2ccccc2n1 |
| InChI | InChI=1S/C15H18N2O2/c1-2-5-11-10-14(16-9-8-15(18)19)12-6-3-4-7-13(12)17-11/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | VKXOBPHDIMHVOE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |