C18H15FN2O2 — CID 110432713
2-[4-[(4-fluorophenyl)methylamino]quinolin-2-yl]acetic acid (PubChem CID 110432713) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[4-[(4-fluorophenyl)methylamino]quinolin-2-yl]acetic acid.
| Compound Name | 2-[4-[(4-fluorophenyl)methylamino]quinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 110432713 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[4-[(4-fluorophenyl)methylamino]quinolin-2-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(NCc2ccc(F)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C18H15FN2O2/c19-13-7-5-12(6-8-13)11-20-17-9-14(10-18(22)23)21-16-4-2-1-3-15(16)17/h1-9H,10-11H2,(H,20,21)(H,22,23) |
| InChIKey | MUCNRFJNWHEZTM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |