C30H38ClN5O8 — CID 11157943
2-[[2-[8-[(6-chloro-2-methoxyacridin-9-yl)amino]octylamino]-2-oxoethyl]-[2-(dicarboxyamino)ethyl]amino]acetic acid (PubChem CID 11157943) has the molecular formula C30H38ClN5O8 and a molecular weight of 632.11 g/mol. Its IUPAC name is 2-[[2-[8-[(6-chloro-2-methoxyacridin-9-yl)amino]octylamino]-2-oxoethyl]-[2-(dicarboxyamino)ethyl]amino]acetic acid.
| Compound Name | 2-[[2-[8-[(6-chloro-2-methoxyacridin-9-yl)amino]octylamino]-2-oxoethyl]-[2-(dicarboxyamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 11157943 |
| Molecular Formula | C30H38ClN5O8 |
| Molecular Weight | 632.11 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 2-[[2-[8-[(6-chloro-2-methoxyacridin-9-yl)amino]octylamino]-2-oxoethyl]-[2-(dicarboxyamino)ethyl]amino]acetic acid |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCCCCCNC(=O)CN(CCN(C(=O)O)C(=O)O)CC(=O)O)c2c1 |
| InChI | InChI=1S/C30H38ClN5O8/c1-44-21-9-11-24-23(17-21)28(22-10-8-20(31)16-25(22)34-24)33-13-7-5-3-2-4-6-12-32-26(37)18-35(19-27(38)39)14-15-36(29(40)41)30(42)43/h8-11,16-17H,2-7,12-15,18-19H2,1H3,(H,32,37)(H,33,34)(H,38,39)(H,40,41)(H,42,43) |
| InChIKey | ZUDRZQXUBUDTFN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 181.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.11 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|