C32H42ClN5O8 — CID 11456552
ethyl 2-[2-[bis(ethoxycarbonyl)amino]ethyl-[2-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butylamino]-2-oxoethyl]amino]acetate (PubChem CID 11456552) has the molecular formula C32H42ClN5O8 and a molecular weight of 660.17 g/mol. Its IUPAC name is ethyl 2-[2-[bis(ethoxycarbonyl)amino]ethyl-[2-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butylamino]-2-oxoethyl]amino]acetate.
| Compound Name | ethyl 2-[2-[bis(ethoxycarbonyl)amino]ethyl-[2-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butylamino]-2-oxoethyl]amino]acetate |
|---|---|
| PubChem CID | 11456552 |
| Molecular Formula | C32H42ClN5O8 |
| Molecular Weight | 660.17 g/mol |
| Exact Mass | 659.27 |
| IUPAC Name | ethyl 2-[2-[bis(ethoxycarbonyl)amino]ethyl-[2-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]butylamino]-2-oxoethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCN(C(=O)OCC)C(=O)OCC)CC(=O)NCCCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C32H42ClN5O8/c1-5-44-29(40)21-37(16-17-38(31(41)45-6-2)32(42)46-7-3)20-28(39)34-14-8-9-15-35-30-24-12-10-22(33)18-27(24)36-26-13-11-23(43-4)19-25(26)30/h10-13,18-19H,5-9,14-17,20-21H2,1-4H3,(H,34,39)(H,35,36) |
| InChIKey | QSAFZUFBZFSESC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|