C36H51N5O7 — CID 11388260
ethyl 2-[[2-[7-(acridin-9-ylamino)heptylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate (PubChem CID 11388260) has the molecular formula C36H51N5O7 and a molecular weight of 665.83 g/mol. Its IUPAC name is ethyl 2-[[2-[7-(acridin-9-ylamino)heptylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[7-(acridin-9-ylamino)heptylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 11388260 |
| Molecular Formula | C36H51N5O7 |
| Molecular Weight | 665.83 g/mol |
| Exact Mass | 665.38 |
| IUPAC Name | ethyl 2-[[2-[7-(acridin-9-ylamino)heptylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCN(CC(=O)OCC)CC(=O)OCC)CC(=O)NCCCCCCCNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C36H51N5O7/c1-4-46-33(43)25-40(22-23-41(26-34(44)47-5-2)27-35(45)48-6-3)24-32(42)37-20-14-8-7-9-15-21-38-36-28-16-10-12-18-30(28)39-31-19-13-11-17-29(31)36/h10-13,16-19H,4-9,14-15,20-27H2,1-3H3,(H,37,42)(H,38,39) |
| InChIKey | ZZJNSDIBDNVFCE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.83 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|