C32H43N5O7 — CID 11376986
ethyl 2-[[2-[3-(acridin-9-ylamino)propylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate (PubChem CID 11376986) has the molecular formula C32H43N5O7 and a molecular weight of 609.72 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(acridin-9-ylamino)propylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-(acridin-9-ylamino)propylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 11376986 |
| Molecular Formula | C32H43N5O7 |
| Molecular Weight | 609.72 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | ethyl 2-[[2-[3-(acridin-9-ylamino)propylamino]-2-oxoethyl]-[2-[bis(2-ethoxy-2-oxoethyl)amino]ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCN(CC(=O)OCC)CC(=O)OCC)CC(=O)NCCCNc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C32H43N5O7/c1-4-42-29(39)21-36(18-19-37(22-30(40)43-5-2)23-31(41)44-6-3)20-28(38)33-16-11-17-34-32-24-12-7-9-14-26(24)35-27-15-10-8-13-25(27)32/h7-10,12-15H,4-6,11,16-23H2,1-3H3,(H,33,38)(H,34,35) |
| InChIKey | OXKBIHFXGZDWDS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.72 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|