C29H36ClN5O8 — CID 11319525
ethyl N-[2-[bis(ethoxycarbonyl)amino]ethyl]-N-[2-[2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethylamino]-2-oxoethyl]carbamate (PubChem CID 11319525) has the molecular formula C29H36ClN5O8 and a molecular weight of 618.09 g/mol. Its IUPAC name is ethyl N-[2-[bis(ethoxycarbonyl)amino]ethyl]-N-[2-[2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | ethyl N-[2-[bis(ethoxycarbonyl)amino]ethyl]-N-[2-[2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 11319525 |
| Molecular Formula | C29H36ClN5O8 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | ethyl N-[2-[bis(ethoxycarbonyl)amino]ethyl]-N-[2-[2-[(6-chloro-2-methoxyacridin-9-yl)amino]ethylamino]-2-oxoethyl]carbamate |
| SMILES | CCOC(=O)N(CCN(C(=O)OCC)C(=O)OCC)CC(=O)NCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C29H36ClN5O8/c1-5-41-27(37)34(14-15-35(28(38)42-6-2)29(39)43-7-3)18-25(36)31-12-13-32-26-21-10-8-19(30)16-24(21)33-23-11-9-20(40-4)17-22(23)26/h8-11,16-17H,5-7,12-15,18H2,1-4H3,(H,31,36)(H,32,33) |
| InChIKey | MOMVUDCXCKIOLB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 148.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|