C35H39N5O2 — CID 52943836
N-[2-(dimethylamino)ethyl]-9-[6-(naphthalene-1-carbonylamino)hexylamino]acridine-3-carboxamide (PubChem CID 52943836) has the molecular formula C35H39N5O2 and a molecular weight of 561.73 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-9-[6-(naphthalene-1-carbonylamino)hexylamino]acridine-3-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-9-[6-(naphthalene-1-carbonylamino)hexylamino]acridine-3-carboxamide |
|---|---|
| PubChem CID | 52943836 |
| Molecular Formula | C35H39N5O2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-9-[6-(naphthalene-1-carbonylamino)hexylamino]acridine-3-carboxamide |
| SMILES | CN(C)CCNC(=O)c1ccc2c(NCCCCCCNC(=O)c3cccc4ccccc34)c3ccccc3nc2c1 |
| InChI | InChI=1S/C35H39N5O2/c1-40(2)23-22-38-34(41)26-18-19-30-32(24-26)39-31-17-8-7-15-29(31)33(30)36-20-9-3-4-10-21-37-35(42)28-16-11-13-25-12-5-6-14-27(25)28/h5-8,11-19,24H,3-4,9-10,20-23H2,1-2H3,(H,36,39)(H,37,42)(H,38,41) |
| InChIKey | NUWYXQPHWXKRFP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|