C44H70N6O3 — CID 54326596
6-(4-azido-2-nitroanilino)-N-(7,18-dicyclopentyl-5-tricyclo[11.9.0.02,12]docosanyl)hexanamide (PubChem CID 54326596) has the molecular formula C44H70N6O3 and a molecular weight of 731.08 g/mol. Its IUPAC name is 6-(4-azido-2-nitroanilino)-N-(7,18-dicyclopentyl-5-tricyclo[11.9.0.02,12]docosanyl)hexanamide.
| Compound Name | 6-(4-azido-2-nitroanilino)-N-(7,18-dicyclopentyl-5-tricyclo[11.9.0.02,12]docosanyl)hexanamide |
|---|---|
| PubChem CID | 54326596 |
| Molecular Formula | C44H70N6O3 |
| Molecular Weight | 731.08 g/mol |
| Exact Mass | 730.55 |
| IUPAC Name | 6-(4-azido-2-nitroanilino)-N-(7,18-dicyclopentyl-5-tricyclo[11.9.0.02,12]docosanyl)hexanamide |
| SMILES | [N-]=[N+]=Nc1ccc(NCCCCCC(=O)NC2CCC3C4CCCCC(C5CCCC5)CCCCC4C3CCCCC(C3CCCC3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C44H70N6O3/c45-49-48-37-26-28-42(43(31-37)50(52)53)46-29-13-1-2-24-44(51)47-36-25-27-41-39-22-11-8-17-33(32-14-3-4-15-32)16-7-10-21-38(39)40(41)23-12-9-20-35(30-36)34-18-5-6-19-34/h26,28,31-36,38-41,46H,1-25,27,29-30H2,(H,47,51) |
| InChIKey | SVJRJVNAKUDSBF-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.08 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|