C22H36N8O7 — CID 176786826
N-[3-[3-(4-azido-2-nitroanilino)propyl-[3-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]amino]propyl]formamide (PubChem CID 176786826) has the molecular formula C22H36N8O7 and a molecular weight of 524.58 g/mol. Its IUPAC name is N-[3-[3-(4-azido-2-nitroanilino)propyl-[3-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]amino]propyl]formamide.
| Compound Name | N-[3-[3-(4-azido-2-nitroanilino)propyl-[3-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]amino]propyl]formamide |
|---|---|
| PubChem CID | 176786826 |
| Molecular Formula | C22H36N8O7 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | N-[3-[3-(4-azido-2-nitroanilino)propyl-[3-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]propyl]amino]propyl]formamide |
| SMILES | [N-]=[N+]=Nc1ccc(NCCCN(CCCNC=O)CCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H36N8O7/c23-27-26-16-4-5-17(18(12-16)30(36)37)25-7-2-9-28(8-1-6-24-15-32)10-3-11-29-13-20(33)22(35)21(34)19(29)14-31/h4-5,12,15,19-22,25,31,33-35H,1-3,6-11,13-14H2,(H,24,32)/t19-,20+,21-,22-/m1/s1 |
| InChIKey | RQICRTMHEHCSMO-CIAFKFPVSA-N |
| XLogP | -0.07 |
| TPSA | 220.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|