C21H31N5O6 — CID 121330397
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyrazol-1-ylanilino)hexyl]piperidine-3,4,5-triol (PubChem CID 121330397) has the molecular formula C21H31N5O6 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyrazol-1-ylanilino)hexyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyrazol-1-ylanilino)hexyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330397 |
| Molecular Formula | C21H31N5O6 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[6-(2-nitro-4-pyrazol-1-ylanilino)hexyl]piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1cc(-n2cccn2)ccc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C21H31N5O6/c27-14-18-20(29)21(30)19(28)13-24(18)10-4-2-1-3-8-22-16-7-6-15(12-17(16)26(31)32)25-11-5-9-23-25/h5-7,9,11-12,18-22,27-30H,1-4,8,10,13-14H2/t18-,19+,20-,21-/m1/s1 |
| InChIKey | ZAFQTKGYXVCRST-PLACYPQZSA-N |
| XLogP | 0.51 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|