C20H32N6O6 — CID 121330465
(2R,3R,4R,5S)-1-[6-[5-(1,3-dihydro-1,2,4-triazol-2-yl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 121330465) has the molecular formula C20H32N6O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-[5-(1,3-dihydro-1,2,4-triazol-2-yl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-[5-(1,3-dihydro-1,2,4-triazol-2-yl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 121330465 |
| Molecular Formula | C20H32N6O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-[5-(1,3-dihydro-1,2,4-triazol-2-yl)-2-nitroanilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | O=[N+]([O-])c1ccc(N2CN=CN2)cc1NCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C20H32N6O6/c27-11-17-19(29)20(30)18(28)10-24(17)8-4-2-1-3-7-22-15-9-14(25-13-21-12-23-25)5-6-16(15)26(31)32/h5-6,9,12,17-20,22,27-30H,1-4,7-8,10-11,13H2,(H,21,23)/t17-,18+,19-,20-/m1/s1 |
| InChIKey | OXFQOWLOAIUWOG-IYWMVGAKSA-N |
| XLogP | -0.36 |
| TPSA | 166.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|