C19H33N7O4 — CID 145078110
N,N'-diamino-N-[3-[6-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-4-nitrophenyl]methanimidamide (PubChem CID 145078110) has the molecular formula C19H33N7O4 and a molecular weight of 423.52 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[6-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-4-nitrophenyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[6-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-4-nitrophenyl]methanimidamide |
|---|---|
| PubChem CID | 145078110 |
| Molecular Formula | C19H33N7O4 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N,N'-diamino-N-[3-[6-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-4-nitrophenyl]methanimidamide |
| SMILES | N/N=C\N(N)c1ccc([N+](=O)[O-])c(NCCCCCCN2CCC(O)CC2CO)c1 |
| InChI | InChI=1S/C19H33N7O4/c20-23-14-25(21)15-5-6-19(26(29)30)18(12-15)22-8-3-1-2-4-9-24-10-7-17(28)11-16(24)13-27/h5-6,12,14,16-17,22,27-28H,1-4,7-11,13,20-21H2/b23-14- |
| InChIKey | FARSQJZVMNSOFI-UCQKPKSFSA-N |
| XLogP | 0.97 |
| TPSA | 166.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|