C24H32N4O5 — CID 162439281
2-(hydroxymethyl)-1-[[4-[[2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidin-4-ol (PubChem CID 162439281) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-[[4-[[2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidin-4-ol.
| Compound Name | 2-(hydroxymethyl)-1-[[4-[[2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 162439281 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 2-(hydroxymethyl)-1-[[4-[[2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidin-4-ol |
| SMILES | O=[N+]([O-])c1cc(CN2CCCO2)ccc1NCc1ccc(CN2CCC(O)CC2CO)cc1 |
| InChI | InChI=1S/C24H32N4O5/c29-17-21-13-22(30)8-10-26(21)15-19-4-2-18(3-5-19)14-25-23-7-6-20(12-24(23)28(31)32)16-27-9-1-11-33-27/h2-7,12,21-22,25,29-30H,1,8-11,13-17H2 |
| InChIKey | BWOQCXKOAYKPFX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|