C25H34N4O7 — CID 175895612
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[[N-methyl-2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidine-3,4,5-triol (PubChem CID 175895612) has the molecular formula C25H34N4O7 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[[N-methyl-2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[[N-methyl-2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 175895612 |
| Molecular Formula | C25H34N4O7 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[[3-[[N-methyl-2-nitro-4-(1,2-oxazolidin-2-ylmethyl)anilino]methyl]phenyl]methyl]piperidine-3,4,5-triol |
| SMILES | CN(Cc1cccc(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c1)c1ccc(CN2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H34N4O7/c1-26(20-7-6-19(11-21(20)29(34)35)14-28-8-3-9-36-28)12-17-4-2-5-18(10-17)13-27-15-23(31)25(33)24(32)22(27)16-30/h2,4-7,10-11,22-25,30-33H,3,8-9,12-16H2,1H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | LJVWVHJPDYMINT-ZFFYZDHPSA-N |
| XLogP | 0.63 |
| TPSA | 143.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|