C10H12N2O3 — CID 162439439
2-[(4-nitrophenyl)methyl]-1,2-oxazolidine (PubChem CID 162439439) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)methyl]-1,2-oxazolidine.
| Compound Name | 2-[(4-nitrophenyl)methyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 162439439 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-[(4-nitrophenyl)methyl]-1,2-oxazolidine |
| SMILES | O=[N+]([O-])c1ccc(CN2CCCO2)cc1 |
| InChI | InChI=1S/C10H12N2O3/c13-12(14)10-4-2-9(3-5-10)8-11-6-1-7-15-11/h2-5H,1,6-8H2 |
| InChIKey | OFOIJQGJWQTESO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|