C20H34N4O4 — CID 162439534
1-[(E)-6-(4-amino-2-nitroanilino)hex-3-enyl]-2-(hydroxymethyl)piperidin-4-ol;ethane (PubChem CID 162439534) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[(E)-6-(4-amino-2-nitroanilino)hex-3-enyl]-2-(hydroxymethyl)piperidin-4-ol;ethane.
| Compound Name | 1-[(E)-6-(4-amino-2-nitroanilino)hex-3-enyl]-2-(hydroxymethyl)piperidin-4-ol;ethane |
|---|---|
| PubChem CID | 162439534 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 1-[(E)-6-(4-amino-2-nitroanilino)hex-3-enyl]-2-(hydroxymethyl)piperidin-4-ol;ethane |
| SMILES | CC.Nc1ccc(NCC/C=C/CCN2CCC(O)CC2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H28N4O4.C2H6/c19-14-5-6-17(18(11-14)22(25)26)20-8-3-1-2-4-9-21-10-7-16(24)12-15(21)13-23;1-2/h1-2,5-6,11,15-16,20,23-24H,3-4,7-10,12-13,19H2;1-2H3/b2-1+; |
| InChIKey | FOSBBFLNXJYJII-TYYBGVCCSA-N |
| XLogP | 2.77 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|