C17H27N5O6 — CID 162439236
2-(4-amino-2-nitroanilino)ethyl N-[2-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamate (PubChem CID 162439236) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-(4-amino-2-nitroanilino)ethyl N-[2-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamate.
| Compound Name | 2-(4-amino-2-nitroanilino)ethyl N-[2-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 162439236 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-(4-amino-2-nitroanilino)ethyl N-[2-[4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]ethyl]carbamate |
| SMILES | Nc1ccc(NCCOC(=O)NCCN2CCC(O)CC2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H27N5O6/c18-12-1-2-15(16(9-12)22(26)27)19-5-8-28-17(25)20-4-7-21-6-3-14(24)10-13(21)11-23/h1-2,9,13-14,19,23-24H,3-8,10-11,18H2,(H,20,25) |
| InChIKey | AIFCJVBFGZYJGF-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 163.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|