C19H31N5O5 — CID 145404752
N'-hydroxy-4-[6-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-3-nitrobenzenecarboximidamide (PubChem CID 145404752) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is N'-hydroxy-4-[6-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-3-nitrobenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[6-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-3-nitrobenzenecarboximidamide |
|---|---|
| PubChem CID | 145404752 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N'-hydroxy-4-[6-[(2S,4R)-4-hydroxy-2-(hydroxymethyl)piperidin-1-yl]hexylamino]-3-nitrobenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(NCCCCCCN2CC[C@@H](O)C[C@H]2CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H31N5O5/c20-19(22-27)14-5-6-17(18(11-14)24(28)29)21-8-3-1-2-4-9-23-10-7-16(26)12-15(23)13-25/h5-6,11,15-16,21,25-27H,1-4,7-10,12-13H2,(H2,20,22)/t15-,16+/m0/s1 |
| InChIKey | CUDMTYBNFLHGLZ-JKSUJKDBSA-N |
| XLogP | 1.48 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|