C20H26N8O6 — CID 175895779
1-[2-[2-[2-(4-azido-2-nitroanilino)ethyl]pyrimidin-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 175895779) has the molecular formula C20H26N8O6 and a molecular weight of 474.48 g/mol. Its IUPAC name is 1-[2-[2-[2-(4-azido-2-nitroanilino)ethyl]pyrimidin-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | 1-[2-[2-[2-(4-azido-2-nitroanilino)ethyl]pyrimidin-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 175895779 |
| Molecular Formula | C20H26N8O6 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 1-[2-[2-[2-(4-azido-2-nitroanilino)ethyl]pyrimidin-4-yl]ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(NCCc2nccc(CCN3CC(O)C(O)C(O)C3CO)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H26N8O6/c21-26-25-13-1-2-14(15(9-13)28(33)34)22-7-4-18-23-6-3-12(24-18)5-8-27-10-17(30)20(32)19(31)16(27)11-29/h1-3,6,9,16-17,19-20,22,29-32H,4-5,7-8,10-11H2 |
| InChIKey | KDZXUKGRLUHTEY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 213.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|