C24H44N4O4 — CID 162439318
(2R,3R,4R,5S)-1-[6-[2,4-bis[(dimethylamino)methyl]anilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 162439318) has the molecular formula C24H44N4O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is (2R,3R,4R,5S)-1-[6-[2,4-bis[(dimethylamino)methyl]anilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-1-[6-[2,4-bis[(dimethylamino)methyl]anilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 162439318 |
| Molecular Formula | C24H44N4O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | (2R,3R,4R,5S)-1-[6-[2,4-bis[(dimethylamino)methyl]anilino]hexyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CN(C)Cc1ccc(NCCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)c(CN(C)C)c1 |
| InChI | InChI=1S/C24H44N4O4/c1-26(2)14-18-9-10-20(19(13-18)15-27(3)4)25-11-7-5-6-8-12-28-16-22(30)24(32)23(31)21(28)17-29/h9-10,13,21-25,29-32H,5-8,11-12,14-17H2,1-4H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | XPGTWYLSKSYGPT-UEQSERJNSA-N |
| XLogP | 0.54 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|