C25H41N3O5 — CID 71766522
1-cyclohexyl-3-phenyl-1-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea (PubChem CID 71766522) has the molecular formula C25H41N3O5 and a molecular weight of 463.62 g/mol. Its IUPAC name is 1-cyclohexyl-3-phenyl-1-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea.
| Compound Name | 1-cyclohexyl-3-phenyl-1-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
|---|---|
| PubChem CID | 71766522 |
| Molecular Formula | C25H41N3O5 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | 1-cyclohexyl-3-phenyl-1-[6-[(2R,3R,4R,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)piperidin-1-yl]hexyl]urea |
| SMILES | O=C(Nc1ccccc1)N(CCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)C1CCCCC1 |
| InChI | InChI=1S/C25H41N3O5/c29-18-21-23(31)24(32)22(30)17-27(21)15-9-1-2-10-16-28(20-13-7-4-8-14-20)25(33)26-19-11-5-3-6-12-19/h3,5-6,11-12,20-24,29-32H,1-2,4,7-10,13-18H2,(H,26,33)/t21-,22+,23-,24-/m1/s1 |
| InChIKey | JXEBLXZAVWSGMF-UEQSERJNSA-N |
| XLogP | 2.17 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|