C23H27N3O — CID 1214877
1-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea (PubChem CID 1214877) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 1-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea.
| Compound Name | 1-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 1214877 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-cyclohexyl-1-[2-(1H-indol-3-yl)ethyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)N(CCc1c[nH]c2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C23H27N3O/c27-23(25-19-9-3-1-4-10-19)26(20-11-5-2-6-12-20)16-15-18-17-24-22-14-8-7-13-21(18)22/h1,3-4,7-10,13-14,17,20,24H,2,5-6,11-12,15-16H2,(H,25,27) |
| InChIKey | UXVQSLFPMQVCCI-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |