C14H19FN2O2 — CID 54944714
1-cyclopentyl-3-(4-fluorophenyl)-1-(2-hydroxyethyl)urea (PubChem CID 54944714) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 1-cyclopentyl-3-(4-fluorophenyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 54944714 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-cyclopentyl-3-(4-fluorophenyl)-1-(2-hydroxyethyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N(CCO)C1CCCC1 |
| InChI | InChI=1S/C14H19FN2O2/c15-11-5-7-12(8-6-11)16-14(19)17(9-10-18)13-3-1-2-4-13/h5-8,13,18H,1-4,9-10H2,(H,16,19) |
| InChIKey | IFSVTWJIHRITMU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |