C12H14BrFN2O2 — CID 111476030
3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea (PubChem CID 111476030) has the molecular formula C12H14BrFN2O2 and a molecular weight of 317.16 g/mol. Its IUPAC name is 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 111476030 |
| Molecular Formula | C12H14BrFN2O2 |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-(3-bromo-5-fluorophenyl)-1-cyclopropyl-1-(2-hydroxyethyl)urea |
| SMILES | O=C(Nc1cc(F)cc(Br)c1)N(CCO)C1CC1 |
| InChI | InChI=1S/C12H14BrFN2O2/c13-8-5-9(14)7-10(6-8)15-12(18)16(3-4-17)11-1-2-11/h5-7,11,17H,1-4H2,(H,15,18) |
| InChIKey | KIWUZOHYASVHHT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |