C13H13F3N2O3 — CID 62813928
3-[cyclopropyl-[(3,4,5-trifluorophenyl)carbamoyl]amino]propanoic acid (PubChem CID 62813928) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 3-[cyclopropyl-[(3,4,5-trifluorophenyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[(3,4,5-trifluorophenyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 62813928 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-[cyclopropyl-[(3,4,5-trifluorophenyl)carbamoyl]amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)Nc1cc(F)c(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H13F3N2O3/c14-9-5-7(6-10(15)12(9)16)17-13(21)18(8-1-2-8)4-3-11(19)20/h5-6,8H,1-4H2,(H,17,21)(H,19,20) |
| InChIKey | VQUCNPPLXNEUFI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|