C13H17FN2O4S — CID 75391286
1-(1,1-dioxothiolan-3-yl)-3-(3-fluorophenyl)-1-(2-hydroxyethyl)urea (PubChem CID 75391286) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(3-fluorophenyl)-1-(2-hydroxyethyl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-fluorophenyl)-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 75391286 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(3-fluorophenyl)-1-(2-hydroxyethyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)N(CCO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17FN2O4S/c14-10-2-1-3-11(8-10)15-13(18)16(5-6-17)12-4-7-21(19,20)9-12/h1-3,8,12,17H,4-7,9H2,(H,15,18) |
| InChIKey | YHJGVHDKRKVGCL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |