C27H36N4O10 — CID 121330441
[(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[6-(4-cyano-2-nitroanilino)hexyl]piperidin-2-yl]methyl acetate (PubChem CID 121330441) has the molecular formula C27H36N4O10 and a molecular weight of 576.60 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[6-(4-cyano-2-nitroanilino)hexyl]piperidin-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[6-(4-cyano-2-nitroanilino)hexyl]piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 121330441 |
| Molecular Formula | C27H36N4O10 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | [(2R,3R,4R,5S)-3,4,5-triacetyloxy-1-[6-(4-cyano-2-nitroanilino)hexyl]piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)CN1CCCCCCNc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H36N4O10/c1-17(32)38-16-24-26(40-19(3)34)27(41-20(4)35)25(39-18(2)33)15-30(24)12-8-6-5-7-11-29-22-10-9-21(14-28)13-23(22)31(36)37/h9-10,13,24-27,29H,5-8,11-12,15-16H2,1-4H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | LASQKMFXXIDZDB-HVWQDESWSA-N |
| XLogP | 2.48 |
| TPSA | 187.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|