About 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione
5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione (PubChem CID 175215119) has the molecular formula C11H9N5O6
and a molecular weight of 307.22 g/mol. Its IUPAC name is 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione |
| PubChem CID | 175215119 |
| Molecular Formula | C11H9N5O6 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.[N-]=[N+]=Nc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| InChI | InChI=1S/C7H4N4O4.C4H5NO2/c8-10-9-4-1-2-6(11(14)15)5(3-4)7(12)13;6-3-1-2-4(7)5-3/h1-3H,(H,12,13);1-2H2,(H,5,6,7) |
| InChIKey | LZRAEACXGKYRMF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione?
The IUPAC name of 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione (CID 175215119) is 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione.
What is the SMILES notation for 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione?
The canonical SMILES for 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione is O=C1CCC(=O)N1.[N-]=[N+]=Nc1ccc([N+](=O)[O-])c(C(=O)O)c1.
What is the InChIKey of 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione?
The InChIKey is LZRAEACXGKYRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4N4O4.C4H5NO2/c8-10-9-4-1-2-6(11(14)15)5(3-4)7(12)13;6-3-1-2-4(7)5-3/h1-3H,(H,12,13);1-2H2,(H,5,6,7).
What are the key properties of 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione?
5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione has a molecular weight of 307.22 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-2-nitrobenzoic acid;pyrrolidine-2,5-dione is sourced from PubChem (CID 175215119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).