C17H20N4O5 — CID 21160205
[(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl] 5-azido-2-nitrobenzoate (PubChem CID 21160205) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is [(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl] 5-azido-2-nitrobenzoate.
| Compound Name | [(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl] 5-azido-2-nitrobenzoate |
|---|---|
| PubChem CID | 21160205 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(E)-5-(3,3-dimethyloxiran-2-yl)-3-methylpent-2-enyl] 5-azido-2-nitrobenzoate |
| SMILES | C/C(=C\COC(=O)c1cc(N=[N+]=[N-])ccc1[N+](=O)[O-])CCC1OC1(C)C |
| InChI | InChI=1S/C17H20N4O5/c1-11(4-7-15-17(2,3)26-15)8-9-25-16(22)13-10-12(19-20-18)5-6-14(13)21(23)24/h5-6,8,10,15H,4,7,9H2,1-3H3/b11-8+ |
| InChIKey | HESJACSKTMRWED-DHZHZOJOSA-N |
| XLogP | 4.60 |
| TPSA | 130.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|