C16H20N4O4 — CID 5366249
3-[(E)-5-(4-azido-2-nitrophenoxy)-4-methylpent-3-enyl]-2,2-dimethyloxirane (PubChem CID 5366249) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-[(E)-5-(4-azido-2-nitrophenoxy)-4-methylpent-3-enyl]-2,2-dimethyloxirane.
| Compound Name | 3-[(E)-5-(4-azido-2-nitrophenoxy)-4-methylpent-3-enyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 5366249 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 3-[(E)-5-(4-azido-2-nitrophenoxy)-4-methylpent-3-enyl]-2,2-dimethyloxirane |
| SMILES | C/C(=C\CCC1OC1(C)C)COc1ccc(N=[N+]=[N-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O4/c1-11(5-4-6-15-16(2,3)24-15)10-23-14-8-7-12(18-19-17)9-13(14)20(21)22/h5,7-9,15H,4,6,10H2,1-3H3/b11-5+ |
| InChIKey | PHSIBDCWRNZFMY-VZUCSPMQSA-N |
| XLogP | 4.82 |
| TPSA | 113.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|