C16H16N6O10S3 — CID 3035982
1-[3-[2-[(5-azido-2-nitrobenzoyl)amino]ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid (PubChem CID 3035982) has the molecular formula C16H16N6O10S3 and a molecular weight of 548.54 g/mol. Its IUPAC name is 1-[3-[2-[(5-azido-2-nitrobenzoyl)amino]ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid.
| Compound Name | 1-[3-[2-[(5-azido-2-nitrobenzoyl)amino]ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 3035982 |
| Molecular Formula | C16H16N6O10S3 |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 1-[3-[2-[(5-azido-2-nitrobenzoyl)amino]ethyldisulfanyl]propanoyloxy]-2,5-dioxopyrrolidine-3-sulfonic acid |
| SMILES | [N-]=[N+]=Nc1ccc([N+](=O)[O-])c(C(=O)NCCSSCCC(=O)ON2C(=O)CC(S(=O)(=O)O)C2=O)c1 |
| InChI | InChI=1S/C16H16N6O10S3/c17-20-19-9-1-2-11(22(27)28)10(7-9)15(25)18-4-6-34-33-5-3-14(24)32-21-13(23)8-12(16(21)26)35(29,30)31/h1-2,7,12H,3-6,8H2,(H,18,25)(H,29,30,31) |
| InChIKey | ARITXILJMFZEQM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 239.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|