C20H22N6O7S2 — CID 175104849
5-azido-N-[5-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]-2,2-bis(sulfanyl)pentyl]-2-nitrobenzamide (PubChem CID 175104849) has the molecular formula C20H22N6O7S2 and a molecular weight of 522.57 g/mol. Its IUPAC name is 5-azido-N-[5-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]-2,2-bis(sulfanyl)pentyl]-2-nitrobenzamide.
| Compound Name | 5-azido-N-[5-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]-2,2-bis(sulfanyl)pentyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 175104849 |
| Molecular Formula | C20H22N6O7S2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | 5-azido-N-[5-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]-2,2-bis(sulfanyl)pentyl]-2-nitrobenzamide |
| SMILES | [N-]=[N+]=Nc1ccc([N+](=O)[O-])c(C(=O)NCC(S)(S)CCCOCc2ccc(CO)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H22N6O7S2/c21-24-23-15-4-5-17(25(29)30)16(9-15)19(28)22-12-20(34,35)6-1-7-33-11-13-2-3-14(10-27)18(8-13)26(31)32/h2-5,8-9,27,34-35H,1,6-7,10-12H2,(H,22,28) |
| InChIKey | INDVYIWCXCIVBI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 193.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|