C15H21N5O6 — CID 156697499
3-[2-(2-azidoethoxy)ethoxy]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide (PubChem CID 156697499) has the molecular formula C15H21N5O6 and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-[2-(2-azidoethoxy)ethoxy]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide.
| Compound Name | 3-[2-(2-azidoethoxy)ethoxy]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide |
|---|---|
| PubChem CID | 156697499 |
| Molecular Formula | C15H21N5O6 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[2-(2-azidoethoxy)ethoxy]-N-[[4-(hydroxymethyl)-3-nitrophenyl]methyl]propanamide |
| SMILES | [N-]=[N+]=NCCOCCOCCC(=O)NCc1ccc(CO)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H21N5O6/c16-19-18-4-6-26-8-7-25-5-3-15(22)17-10-12-1-2-13(11-21)14(9-12)20(23)24/h1-2,9,21H,3-8,10-11H2,(H,17,22) |
| InChIKey | PFTDSVUDNKXUAX-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 159.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|