C18H22N2O10 — CID 175103420
2-[2-[4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-4-oxobutanoyl]oxyethyl]butanedioic acid (PubChem CID 175103420) has the molecular formula C18H22N2O10 and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-[2-[4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-4-oxobutanoyl]oxyethyl]butanedioic acid.
| Compound Name | 2-[2-[4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-4-oxobutanoyl]oxyethyl]butanedioic acid |
|---|---|
| PubChem CID | 175103420 |
| Molecular Formula | C18H22N2O10 |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-[2-[4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]-4-oxobutanoyl]oxyethyl]butanedioic acid |
| SMILES | O=C(O)CC(CCOC(=O)CCC(=O)NCc1ccc(CO)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C18H22N2O10/c21-10-13-2-1-11(7-14(13)20(28)29)9-19-15(22)3-4-17(25)30-6-5-12(18(26)27)8-16(23)24/h1-2,7,12,21H,3-6,8-10H2,(H,19,22)(H,23,24)(H,26,27) |
| InChIKey | LCLZPJWLAODSLM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 193.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|