C14H19N3O7 — CID 175352910
1,3,2-dioxazolidin-2-yl 4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]butanoate (PubChem CID 175352910) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is 1,3,2-dioxazolidin-2-yl 4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]butanoate.
| Compound Name | 1,3,2-dioxazolidin-2-yl 4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 175352910 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1,3,2-dioxazolidin-2-yl 4-[[4-(hydroxymethyl)-3-nitrophenyl]methylamino]butanoate |
| SMILES | O=C(CCCNCc1ccc(CO)c([N+](=O)[O-])c1)ON1OCCO1 |
| InChI | InChI=1S/C14H19N3O7/c18-10-12-4-3-11(8-13(12)16(20)21)9-15-5-1-2-14(19)24-17-22-6-7-23-17/h3-4,8,15,18H,1-2,5-7,9-10H2 |
| InChIKey | MADHCWQDQTXOMN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|