C16H18N2O8 — CID 175103823
(2,5-dioxopyrrolidin-1-yl) 4-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]butanoate (PubChem CID 175103823) has the molecular formula C16H18N2O8 and a molecular weight of 366.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]butanoate |
|---|---|
| PubChem CID | 175103823 |
| Molecular Formula | C16H18N2O8 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[[4-(hydroxymethyl)-3-nitrophenyl]methoxy]butanoate |
| SMILES | O=C(CCCOCc1ccc(CO)c([N+](=O)[O-])c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H18N2O8/c19-9-12-4-3-11(8-13(12)18(23)24)10-25-7-1-2-16(22)26-17-14(20)5-6-15(17)21/h3-4,8,19H,1-2,5-7,9-10H2 |
| InChIKey | BOKRNOZPAZOGSX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|