C19H22N2O11 — CID 175107466
(2,5-dioxopyrrolidin-1-yl) 2-[2-[3-[4-(hydroxymethyl)-3-nitrophenoxy]-3-oxopropoxy]ethoxy]propanoate (PubChem CID 175107466) has the molecular formula C19H22N2O11 and a molecular weight of 454.39 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-[4-(hydroxymethyl)-3-nitrophenoxy]-3-oxopropoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-[4-(hydroxymethyl)-3-nitrophenoxy]-3-oxopropoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 175107466 |
| Molecular Formula | C19H22N2O11 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[3-[4-(hydroxymethyl)-3-nitrophenoxy]-3-oxopropoxy]ethoxy]propanoate |
| SMILES | CC(OCCOCCC(=O)Oc1ccc(CO)c([N+](=O)[O-])c1)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H22N2O11/c1-12(19(26)32-20-16(23)4-5-17(20)24)30-9-8-29-7-6-18(25)31-14-3-2-13(11-22)15(10-14)21(27)28/h2-3,10,12,22H,4-9,11H2,1H3 |
| InChIKey | PDQYAVBMVPSHOF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|