C13H15NO11S — CID 89241532
5-acetyloxy-2-[3-(2-nitrooxyethoxy)propanoyloxy]benzenesulfonic acid (PubChem CID 89241532) has the molecular formula C13H15NO11S and a molecular weight of 393.33 g/mol. Its IUPAC name is 5-acetyloxy-2-[3-(2-nitrooxyethoxy)propanoyloxy]benzenesulfonic acid.
| Compound Name | 5-acetyloxy-2-[3-(2-nitrooxyethoxy)propanoyloxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 89241532 |
| Molecular Formula | C13H15NO11S |
| Molecular Weight | 393.33 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 5-acetyloxy-2-[3-(2-nitrooxyethoxy)propanoyloxy]benzenesulfonic acid |
| SMILES | CC(=O)Oc1ccc(OC(=O)CCOCCO[N+](=O)[O-])c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C13H15NO11S/c1-9(15)24-10-2-3-11(12(8-10)26(19,20)21)25-13(16)4-5-22-6-7-23-14(17)18/h2-3,8H,4-7H2,1H3,(H,19,20,21) |
| InChIKey | JDERWRQIRPHYHL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|