C10H11NO6S — CID 117060873
(4-acetyloxy-3-sulfamoylphenyl) acetate (PubChem CID 117060873) has the molecular formula C10H11NO6S and a molecular weight of 273.27 g/mol. Its IUPAC name is (4-acetyloxy-3-sulfamoylphenyl) acetate.
| Compound Name | (4-acetyloxy-3-sulfamoylphenyl) acetate |
|---|---|
| PubChem CID | 117060873 |
| Molecular Formula | C10H11NO6S |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (4-acetyloxy-3-sulfamoylphenyl) acetate |
| SMILES | CC(=O)Oc1ccc(OC(C)=O)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H11NO6S/c1-6(12)16-8-3-4-9(17-7(2)13)10(5-8)18(11,14)15/h3-5H,1-2H3,(H2,11,14,15) |
| InChIKey | QPCOZKUEEREFKA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|